CAS 936344-72-8 is the registry number for Ethyl 2-amino-6-chloronicotinate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Ethyl 2-amino-6-chloropyridine-3-carboxylate (CAS 936344-72-8) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: ethyl 2-amino-6-chloropyridine-3-carboxylate. InChIKey: JBNGZIXONGGHIT-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | ethyl 2-amino-6-chloropyridine-3-carboxylate |
| InChIKey | JBNGZIXONGGHIT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1)Cl)N |
Computed by PubChem (NCBI)