CAS 93748-07-3 is the registry number for Alpha,Alpha,3,5-Tetramethyl-benzeneacetonitrile, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.
2-(3,5-dimethylphenyl)-2-methylpropanenitrile (CAS 93748-07-3) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)-2-methylpropanenitrile. InChIKey: XAZSXJIAAJEONQ-UHFFFAOYSA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)-2-methylpropanenitrile |
| InChIKey | XAZSXJIAAJEONQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(C)(C)C#N)C |
Computed by PubChem (NCBI)