Products 937602-20-5
CAS 937602-20-5 is the registry number for 1,3-Bis(3,4-dimethylphenyl)-2-methylpropane-1,3-dione. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1,3-bis(3,4-dimethylphenyl)-2-methylpropane-1,3-dione (CAS 937602-20-5) is a chemical compound with the molecular formula C20H22O2 and a molecular weight of 294.4 g/mol. IUPAC name: 1,3-bis(3,4-dimethylphenyl)-2-methylpropane-1,3-dione. InChIKey: CGJOWGDEVUJEFE-UHFFFAOYSA-N.
| Molecular formula | C20H22O2 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | 1,3-bis(3,4-dimethylphenyl)-2-methylpropane-1,3-dione |
| InChIKey | CGJOWGDEVUJEFE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C(C)C(=O)C2=CC(=C(C=C2)C)C)C |
Computed by PubChem (NCBI)