Products 937605-01-1
CAS 937605-01-1 is the registry number for 4-(4-Ethoxyphenyl)-2-(1-methylindol-3-yl)-4-oxobutanoic acid. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
4-(4-ethoxyphenyl)-2-(1-methylindol-3-yl)-4-oxobutanoic acid (CAS 937605-01-1) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: 4-(4-ethoxyphenyl)-2-(1-methylindol-3-yl)-4-oxobutanoic acid. InChIKey: MQKJFUNACPJMRQ-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 4-(4-ethoxyphenyl)-2-(1-methylindol-3-yl)-4-oxobutanoic acid |
| InChIKey | MQKJFUNACPJMRQ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C(=O)CC(C2=CN(C3=CC=CC=C32)C)C(=O)O |
Computed by PubChem (NCBI)