CAS 937606-27-4 appears in our catalog under these names: 5-Chloro-2-(3-fluorophenoxy)aniline, 97%, 5-Chloro-2-(3-fluorophenoxy)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-chloro-2-(3-fluorophenoxy)aniline (CAS 937606-27-4) is a chemical compound with the molecular formula C12H9ClFNO and a molecular weight of 237.66 g/mol. IUPAC name: 5-chloro-2-(3-fluorophenoxy)aniline. InChIKey: PEWQUXYAJOENIJ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFNO |
|---|---|
| Molecular weight | 237.66 g/mol |
| IUPAC name | 5-chloro-2-(3-fluorophenoxy)aniline |
| InChIKey | PEWQUXYAJOENIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)OC2=C(C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)