Products 946716-93-4
CAS 946716-93-4 appears in our catalog under these names: 2-(3-Chlorophenoxy)-5-fluoroaniline, 95+%, 2-(3-Chlorophenoxy)-5-fluoroaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(3-chlorophenoxy)-5-fluoroaniline (CAS 946716-93-4) is a chemical compound with the molecular formula C12H9ClFNO and a molecular weight of 237.66 g/mol. IUPAC name: 2-(3-chlorophenoxy)-5-fluoroaniline. InChIKey: DZYZNNQMXATNDI-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFNO |
|---|---|
| Molecular weight | 237.66 g/mol |
| IUPAC name | 2-(3-chlorophenoxy)-5-fluoroaniline |
| InChIKey | DZYZNNQMXATNDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OC2=C(C=C(C=C2)F)N |
Computed by PubChem (NCBI)