CAS 1105190-67-7 is the registry number for 2-chloro-3-((2-fluorobenzyl)oxy)pyridine, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-chloro-3-[(2-fluorophenyl)methoxy]pyridine (CAS 1105190-67-7) is a chemical compound with the molecular formula C12H9ClFNO and a molecular weight of 237.66 g/mol. IUPAC name: 2-chloro-3-[(2-fluorophenyl)methoxy]pyridine. InChIKey: HHMPIMNGDYUZFW-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFNO |
|---|---|
| Molecular weight | 237.66 g/mol |
| IUPAC name | 2-chloro-3-[(2-fluorophenyl)methoxy]pyridine |
| InChIKey | HHMPIMNGDYUZFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=C(N=CC=C2)Cl)F |
Computed by PubChem (NCBI)