Products 1161026-07-8
CAS 1161026-07-8 appears in our catalog under these names: 4-(2-Chloro-5-fluorophenoxy)aniline 95%, 4-(2-Chloro-5-fluorophenoxy)benzenamine, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2-chloro-5-fluorophenoxy)aniline (CAS 1161026-07-8) is a chemical compound with the molecular formula C12H9ClFNO and a molecular weight of 237.66 g/mol. IUPAC name: 4-(2-chloro-5-fluorophenoxy)aniline. InChIKey: YULJFMAMJKHWCS-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFNO |
|---|---|
| Molecular weight | 237.66 g/mol |
| IUPAC name | 4-(2-chloro-5-fluorophenoxy)aniline |
| InChIKey | YULJFMAMJKHWCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=C(C=CC(=C2)F)Cl |
Computed by PubChem (NCBI)