CAS 937625-32-6 is the registry number for Ethyl 4-ethoxy-3-nitrobenzoate, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
Ethyl 4-ethoxy-3-nitrobenzoate (CAS 937625-32-6) is a chemical compound with the molecular formula C11H13NO5 and a molecular weight of 239.22 g/mol. IUPAC name: ethyl 4-ethoxy-3-nitrobenzoate. InChIKey: OFGXEABLPOGFPA-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | ethyl 4-ethoxy-3-nitrobenzoate |
| InChIKey | OFGXEABLPOGFPA-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(=O)OCC)[N+](=O)[O-] |
Computed by PubChem (NCBI)