CAS 937717-66-3 appears in our catalog under these names: 1–Methyl–3–(trifluoromethyl)–1H–pyrazole–4–carboxamide, Penthiopyrad-carboxamide, 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide 95+%, 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide, 95+%, 95+%, Penthiopyrad Metabolite PAM. Offered by: GLPBio, Dr. Ehrenstorfer, Ambeed, Chemat, HPC Standards. Available pack sizes: 100mg, 10mg, 250mg, 1g, 1x10mg.
1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide (CAS 937717-66-3) is a chemical compound with the molecular formula C6H6F3N3O and a molecular weight of 193.13 g/mol. IUPAC name: 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide. InChIKey: UTBJLKDVQNCKAS-UHFFFAOYSA-N.
| Molecular formula | C6H6F3N3O |
|---|---|
| Molecular weight | 193.13 g/mol |
| IUPAC name | 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| InChIKey | UTBJLKDVQNCKAS-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(F)(F)F)C(=O)N |
Computed by PubChem (NCBI)