Products 937738-63-1
CAS 937738-63-1 appears in our catalog under these names: Resolvin D1 Methyl Ester, Resolvin D1 methyl ester. Offered by: TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 25mg, 10ug, 25ug, 50ug, 100ug, 10μg, 100μg, 25μg.
Methyl (4Z,7S,8R,9E,11E,13Z,15E,17S,19Z)-7,8,17-trihydroxydocosa-4,9,11,13,15,19-hexaenoate (CAS 937738-63-1) is a chemical compound with the molecular formula C23H34O5 and a molecular weight of 390.5 g/mol. IUPAC name: methyl (4Z,7S,8R,9E,11E,13Z,15E,17S,19Z)-7,8,17-trihydroxydocosa-4,9,11,13,15,19-hexaenoate. InChIKey: WUKVAFWBFGABJN-ZXQGQRHTSA-N.
| Molecular formula | C23H34O5 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | methyl (4Z,7S,8R,9E,11E,13Z,15E,17S,19Z)-7,8,17-trihydroxydocosa-4,9,11,13,15,19-hexaenoate |
| InChIKey | WUKVAFWBFGABJN-ZXQGQRHTSA-N |
| SMILES | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](C/C=C\CCC(=O)OC)O)O)O |
Computed by PubChem (NCBI)