Products 937738-64-2
CAS 937738-64-2 appears in our catalog under these names: 17(R)–Resolvin D1 methyl ester, 17(R)-Resolvin d1 methyl ester. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10μg, 100μg, 25μg, 50μg, 1mg, Get quote.
Methyl (4Z,7S,8R,9E,11E,13Z,15E,17R,19Z)-7,8,17-trihydroxydocosa-4,9,11,13,15,19-hexaenoate (CAS 937738-64-2) is a chemical compound with the molecular formula C23H34O5 and a molecular weight of 390.5 g/mol. IUPAC name: methyl (4Z,7S,8R,9E,11E,13Z,15E,17R,19Z)-7,8,17-trihydroxydocosa-4,9,11,13,15,19-hexaenoate. InChIKey: WUKVAFWBFGABJN-PFYFFMTHSA-N.
| Molecular formula | C23H34O5 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | methyl (4Z,7S,8R,9E,11E,13Z,15E,17R,19Z)-7,8,17-trihydroxydocosa-4,9,11,13,15,19-hexaenoate |
| InChIKey | WUKVAFWBFGABJN-PFYFFMTHSA-N |
| SMILES | CC/C=C\C[C@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](C/C=C\CCC(=O)OC)O)O)O |
Computed by PubChem (NCBI)