CAS 938116-67-7 is the registry number for 2,2-Dimethyl-3-(3-methylphenoxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2,2-dimethyl-3-(3-methylphenoxy)propanoic acid (CAS 938116-67-7) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2,2-dimethyl-3-(3-methylphenoxy)propanoic acid. InChIKey: SUVJPLJPCOHDBK-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 2,2-dimethyl-3-(3-methylphenoxy)propanoic acid |
| InChIKey | SUVJPLJPCOHDBK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)OCC(C)(C)C(=O)O |
Computed by PubChem (NCBI)