Products 938116-67-7

CAS 938116-67-7 is the registry number for 2,2-Dimethyl-3-(3-methylphenoxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2,2-dimethyl-3-(3-methylphenoxy)propanoic acid (CAS 938116-67-7) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2,2-dimethyl-3-(3-methylphenoxy)propanoic acid. InChIKey: SUVJPLJPCOHDBK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O3
Molecular weight208.25 g/mol
IUPAC name2,2-dimethyl-3-(3-methylphenoxy)propanoic acid
InChIKeySUVJPLJPCOHDBK-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)OCC(C)(C)C(=O)O

Computed by PubChem (NCBI)