Products 93888-59-6
CAS 93888-59-6 is the registry number for 9-Oxo-2,7-bisaboladien-15-oic acid. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
(4R)-4-[(E)-6-methyl-4-oxohept-2-en-2-yl]cyclohexene-1-carboxylic acid (CAS 93888-59-6) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. IUPAC name: (4R)-4-[(E)-6-methyl-4-oxohept-2-en-2-yl]cyclohexene-1-carboxylic acid. InChIKey: IVWKCWHRLFIGCR-ZKQHCESOSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 250.33 g/mol |
| IUPAC name | (4R)-4-[(E)-6-methyl-4-oxohept-2-en-2-yl]cyclohexene-1-carboxylic acid |
| InChIKey | IVWKCWHRLFIGCR-ZKQHCESOSA-N |
| SMILES | CC(C)CC(=O)/C=C(\C)/[C@@H]1CCC(=CC1)C(=O)O |
Computed by PubChem (NCBI)