CAS 93952-12-6 appears in our catalog under these names: Diethyl Phthalate-d4, >95% (HPLC), Diethyl Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Phthalic acid, bis-ethyl ester D4, Phthalic acid, bis-ethyl ester D4 100 µg/mL in Acetonitrile, Diethyl phthalate–d4. Offered by: TRC, CDN, Dr. Ehrenstorfer, GLPBio, Sigma-Aldrich. Available pack sizes: 100mg, 10mg, 0,25g, 0,1g, 1ml, 1mg, 5mg, 25MG.
Diethyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 93952-12-6) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 226.26 g/mol. IUPAC name: diethyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: FLKPEMZONWLCSK-KDWZCNHSSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 226.26 g/mol |
| IUPAC name | diethyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | FLKPEMZONWLCSK-KDWZCNHSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCC)C(=O)OCC)[2H])[2H] |
Computed by PubChem (NCBI)