Products 99873-99-1
CAS 99873-99-1 appears in our catalog under these names: Diethyl Phthalate-d14, >95% (GC), Diethyl Phthalate-d14, 99 atom % D, min 98% Chemical Purity, Diethyl phthalate-d14. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 50mg, 5mg, 0,1g, 0,05g, 50 mg, 5 mg.
Bis(1,1,2,2,2-pentadeuterioethyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 99873-99-1) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 236.32 g/mol. IUPAC name: bis(1,1,2,2,2-pentadeuterioethyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: FLKPEMZONWLCSK-NFUPRKAOSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 236.32 g/mol |
| IUPAC name | bis(1,1,2,2,2-pentadeuterioethyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | FLKPEMZONWLCSK-NFUPRKAOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OC([2H])([2H])C([2H])([2H])[2H])C(=O)OC([2H])([2H])C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)