Products 94-14-4
CAS 94-14-4 appears in our catalog under these names: Isobutyl 4–Aminobenzoate, Isobutyl 4-aminobenzoate, Isobutyl 4-aminobenzoate, 98%, 4-Aminobenzoic acid isobutyl ester, 98%, Isobutyl 4-Aminobenzoate, >98.0%(GC)(T). Offered by: GLPBio, Biosynth, Fluorochem, Combi-blocks, TCI. Available pack sizes: 5g, 0,25kg, 0,5kg, 1kg, 5kg, 2kg, 25g, 1g.
2-methylpropyl 4-aminobenzoate (CAS 94-14-4) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 2-methylpropyl 4-aminobenzoate. InChIKey: PUYOAVGNCWPANW-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 2-methylpropyl 4-aminobenzoate |
| InChIKey | PUYOAVGNCWPANW-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)