CAS 940895-85-2 appears in our catalog under these names: 6-(Trifluoromethoxy)nicotinic acid, 95%, 6-(Trifluoromethoxy)nicotinic Acid, 6-(Trifluoromethoxy)nicotinic acid 95+%, 6-(Trifluoromethoxy)-3-pyridinecarboxylic acid, 95+%, 95+%, 6-(Trifluoromethoxy)nicotinic acid, 95+%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 750mg, 0,05g, 0,1g, 0,25g, 0,5g.
6-(trifluoromethoxy)pyridine-3-carboxylic acid (CAS 940895-85-2) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 6-(trifluoromethoxy)pyridine-3-carboxylic acid. InChIKey: NNYMJNIRFKFWIW-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 6-(trifluoromethoxy)pyridine-3-carboxylic acid |
| InChIKey | NNYMJNIRFKFWIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)