CAS 940980-94-9 is the registry number for 6-Ethyl-2,2,4-trimethyl-1,2-dihydroquinoline-8-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-ethyl-2,2,4-trimethyl-1H-quinoline-8-carboxylic acid (CAS 940980-94-9) is a chemical compound with the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. IUPAC name: 6-ethyl-2,2,4-trimethyl-1H-quinoline-8-carboxylic acid. InChIKey: NYBZVKNLJUZWBV-UHFFFAOYSA-N.
| Molecular formula | C15H19NO2 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | 6-ethyl-2,2,4-trimethyl-1H-quinoline-8-carboxylic acid |
| InChIKey | NYBZVKNLJUZWBV-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C(=C1)C(=O)O)NC(C=C2C)(C)C |
Computed by PubChem (NCBI)