Products 941083-97-2
CAS 941083-97-2 appears in our catalog under these names: 1-(2,4,5-Trimethylthieno[2,3-d]pyrimidin-6-yl)ethanone, 95%, 1-{2,4,5-trimethylthieno(2,3-d)pyrimidin-6-yl}ethan-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(2,4,5-trimethylthieno[2,3-d]pyrimidin-6-yl)ethanone (CAS 941083-97-2) is a chemical compound with the molecular formula C11H12N2OS and a molecular weight of 220.29 g/mol. IUPAC name: 1-(2,4,5-trimethylthieno[2,3-d]pyrimidin-6-yl)ethanone. InChIKey: AQPQSRMXIKTHIB-UHFFFAOYSA-N.
| Molecular formula | C11H12N2OS |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 1-(2,4,5-trimethylthieno[2,3-d]pyrimidin-6-yl)ethanone |
| InChIKey | AQPQSRMXIKTHIB-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC(=NC(=C12)C)C)C(=O)C |
Computed by PubChem (NCBI)