Products 941166-95-6
CAS 941166-95-6 appears in our catalog under these names: 3-(2-Chloropropanoyl)-1-(2,4-dimethylphenyl)urea, 95%, 2-Chloro-n-([(2,4-dimethylphenyl)amino]carbonyl)propanamide, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-chloro-N-[(2,4-dimethylphenyl)carbamoyl]propanamide (CAS 941166-95-6) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 2-chloro-N-[(2,4-dimethylphenyl)carbamoyl]propanamide. InChIKey: GNTGXHMDPYNLPZ-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 2-chloro-N-[(2,4-dimethylphenyl)carbamoyl]propanamide |
| InChIKey | GNTGXHMDPYNLPZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)NC(=O)C(C)Cl)C |
Computed by PubChem (NCBI)