CAS 94142-97-9 appears in our catalog under these names: DDe-OH 98%, 2-(1-hydroxyethylidene)-5,5-dimethylcyclohexane-1,3-dione, 98%, 98%, 2-(1-Hydroxyethylidene)-5,5-dimethylcyclohexane-1,3-dione, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1000g, 10g, 1kg.
2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one (CAS 94142-97-9) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one. InChIKey: DIJDAMFZOHSRID-UHFFFAOYSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2-acetyl-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
| InChIKey | DIJDAMFZOHSRID-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(CC(CC1=O)(C)C)O |
Computed by PubChem (NCBI)