Products 94166-64-0
CAS 94166-64-0 appears in our catalog under these names: 2-Chloro-6-nitropyridine 95%, Pyridine, 2-chloro-6-nitro-, 95%, 95%, 2-Chloro-6-nitropyridine, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2-chloro-6-nitropyridine (CAS 94166-64-0) is a chemical compound with the molecular formula C5H3ClN2O2 and a molecular weight of 158.54 g/mol. IUPAC name: 2-chloro-6-nitropyridine. InChIKey: YRSNXUYQRUULNJ-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O2 |
|---|---|
| Molecular weight | 158.54 g/mol |
| IUPAC name | 2-chloro-6-nitropyridine |
| InChIKey | YRSNXUYQRUULNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)