CAS 94235-42-4 is the registry number for 15-Hydroxy-5,6-oxido-7,9,11,13-eicosatetraenoic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(2S,3S)-3-[(1E,3E,5E,7E,9S)-9-hydroxytetradeca-1,3,5,7-tetraenyl]oxiran-2-yl]butanoic acid (CAS 94235-42-4) is a chemical compound with the molecular formula C20H30O4 and a molecular weight of 334.4 g/mol. IUPAC name: 4-[(2S,3S)-3-[(1E,3E,5E,7E,9S)-9-hydroxytetradeca-1,3,5,7-tetraenyl]oxiran-2-yl]butanoic acid. InChIKey: YNHSGCYEQVDEOY-COBRGRBVSA-N.
| Molecular formula | C20H30O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 4-[(2S,3S)-3-[(1E,3E,5E,7E,9S)-9-hydroxytetradeca-1,3,5,7-tetraenyl]oxiran-2-yl]butanoic acid |
| InChIKey | YNHSGCYEQVDEOY-COBRGRBVSA-N |
| SMILES | CCCCC[C@@H](/C=C/C=C/C=C/C=C/[C@H]1[C@@H](O1)CCCC(=O)O)O |
Computed by PubChem (NCBI)