CAS 942427-41-0 appears in our catalog under these names: 4-(1H-Indazol-1-yl)phenol, 95%, 4-(1H-Indazol-1-yl)phenol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-indazol-1-ylphenol (CAS 942427-41-0) is a chemical compound with the molecular formula C13H10N2O and a molecular weight of 210.23 g/mol. IUPAC name: 4-indazol-1-ylphenol. InChIKey: RDPHYKAOPBRCKR-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 4-indazol-1-ylphenol |
| InChIKey | RDPHYKAOPBRCKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN2C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)