CAS 942474-61-5 is the registry number for 8–(4–(Ethylsulfonyl)–2–nitrophenyl)–1,4–dioxa–8–azaspiro(4·5)decane. Offered by: GLPBio. Available pack sizes: 250mg.
8-(4-ethylsulfonyl-2-nitrophenyl)-1,4-dioxa-8-azaspiro[4.5]decane (CAS 942474-61-5) is a chemical compound with the molecular formula C15H20N2O6S and a molecular weight of 356.4 g/mol. IUPAC name: 8-(4-ethylsulfonyl-2-nitrophenyl)-1,4-dioxa-8-azaspiro[4.5]decane. InChIKey: IXDCEECUTHVXMF-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O6S |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 8-(4-ethylsulfonyl-2-nitrophenyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| InChIKey | IXDCEECUTHVXMF-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC(=C(C=C1)N2CCC3(CC2)OCCO3)[N+](=O)[O-] |
Computed by PubChem (NCBI)