Products 94322-82-4

CAS 94322-82-4 is the registry number for 2-[2-(2-Phenoxyethoxy)ethoxy]ethyl prop-2-enoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

2-[2-(2-phenoxyethoxy)ethoxy]ethyl prop-2-enoate (CAS 94322-82-4) is a chemical compound with the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. IUPAC name: 2-[2-(2-phenoxyethoxy)ethoxy]ethyl prop-2-enoate. InChIKey: QGPQONQOUCBWJN-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20O5
Molecular weight280.32 g/mol
IUPAC name2-[2-(2-phenoxyethoxy)ethoxy]ethyl prop-2-enoate
InChIKeyQGPQONQOUCBWJN-UHFFFAOYSA-N
SMILESC=CC(=O)OCCOCCOCCOC1=CC=CC=C1

Computed by PubChem (NCBI)