CAS 943751-30-2 appears in our catalog under these names: 2–Methylisoindolin–5–amine dihydrochloride, 2-Methylisoindolin-5-amine dihydrochloride, 2-Methylisoindolin-5-amine dihydrochloride, 95+%. Offered by: GLPBio, Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g.
2-methyl-1,3-dihydroisoindol-5-amine;dihydrochloride (CAS 943751-30-2) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 2-methyl-1,3-dihydroisoindol-5-amine;dihydrochloride. InChIKey: JLJVEVXJFOMIGF-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 2-methyl-1,3-dihydroisoindol-5-amine;dihydrochloride |
| InChIKey | JLJVEVXJFOMIGF-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(C1)C=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)