CAS 944716-71-6 is the registry number for tert-Butyl ((2S,3S)-1-(cyclopropylamino)-2-hydroxy-1-oxohexan-3-yl)carbamate, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 100mg.
Tert-butyl N-[(2S,3S)-1-(cyclopropylamino)-2-hydroxy-1-oxohexan-3-yl]carbamate (CAS 944716-71-6) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: tert-butyl N-[(2S,3S)-1-(cyclopropylamino)-2-hydroxy-1-oxohexan-3-yl]carbamate. InChIKey: DPFCMHQQTKBKAX-QWRGUYRKSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | tert-butyl N-[(2S,3S)-1-(cyclopropylamino)-2-hydroxy-1-oxohexan-3-yl]carbamate |
| InChIKey | DPFCMHQQTKBKAX-QWRGUYRKSA-N |
| SMILES | CCC[C@@H]([C@@H](C(=O)NC1CC1)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)