CAS 92384-63-9 is the registry number for 1-(4-Bromophenyl)imidazolidine-2,4,5-trione, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(4-bromophenyl)imidazolidine-2,4,5-trione (CAS 92384-63-9) is a chemical compound with the molecular formula C9H5BrN2O3 and a molecular weight of 269.05 g/mol. IUPAC name: 1-(4-bromophenyl)imidazolidine-2,4,5-trione. InChIKey: AWJFJQBDSYCQBL-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O3 |
|---|---|
| Molecular weight | 269.05 g/mol |
| IUPAC name | 1-(4-bromophenyl)imidazolidine-2,4,5-trione |
| InChIKey | AWJFJQBDSYCQBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C(=O)NC2=O)Br |
Computed by PubChem (NCBI)