Products 944900-27-0
CAS 944900-27-0 appears in our catalog under these names: 5-Amino-2-(trifluoromethyl)isonicotinic acid, 5-Amino-2-(trifluoromethyl)isonicotinic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm. Available pack sizes: 0,01g, 0,025g, 0,05g, 0,1g, 250mg, 1g, 50mg, 100mg.
5-amino-2-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 944900-27-0) is a chemical compound with the molecular formula C7H5F3N2O2 and a molecular weight of 206.12 g/mol. IUPAC name: 5-amino-2-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: UTORUAWKVSIHOQ-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O2 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 5-amino-2-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | UTORUAWKVSIHOQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)N)C(=O)O |
Computed by PubChem (NCBI)