Products 944903-98-4
CAS 944903-98-4 is the registry number for Ethyl 5-(trifluoromethyl)-1,3,4-oxadiazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 5-(trifluoromethyl)-1,3,4-oxadiazole-2-carboxylate (CAS 944903-98-4) is a chemical compound with the molecular formula C6H5F3N2O3 and a molecular weight of 210.11 g/mol. IUPAC name: ethyl 5-(trifluoromethyl)-1,3,4-oxadiazole-2-carboxylate. InChIKey: UEWHDKZLUMERPH-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O3 |
|---|---|
| Molecular weight | 210.11 g/mol |
| IUPAC name | ethyl 5-(trifluoromethyl)-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | UEWHDKZLUMERPH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN=C(O1)C(F)(F)F |
Computed by PubChem (NCBI)