Products 1245643-72-4
CAS 1245643-72-4 is the registry number for Ethyl 3-(trifluoromethyl)-1,2,4-oxadiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 3-(trifluoromethyl)-1,2,4-oxadiazole-5-carboxylate (CAS 1245643-72-4) is a chemical compound with the molecular formula C6H5F3N2O3 and a molecular weight of 210.11 g/mol. IUPAC name: ethyl 3-(trifluoromethyl)-1,2,4-oxadiazole-5-carboxylate. InChIKey: NTPSWYWOOBXDNT-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O3 |
|---|---|
| Molecular weight | 210.11 g/mol |
| IUPAC name | ethyl 3-(trifluoromethyl)-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | NTPSWYWOOBXDNT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NO1)C(F)(F)F |
Computed by PubChem (NCBI)