CAS 1803600-75-0 appears in our catalog under these names: Methyl 2-(5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl)acetate, 95%, Methyl 2-(5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
Methyl 2-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]acetate (CAS 1803600-75-0) is a chemical compound with the molecular formula C6H5F3N2O3 and a molecular weight of 210.11 g/mol. IUPAC name: methyl 2-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]acetate. InChIKey: MVRIEFLVQBCSLU-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O3 |
|---|---|
| Molecular weight | 210.11 g/mol |
| IUPAC name | methyl 2-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]acetate |
| InChIKey | MVRIEFLVQBCSLU-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=NN=C(O1)C(F)(F)F |
Computed by PubChem (NCBI)