Products 1339865-89-2
CAS 1339865-89-2 is the registry number for 2-(5-Oxo-3-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[5-oxo-3-(trifluoromethyl)-4H-pyrazol-1-yl]acetic acid (CAS 1339865-89-2) is a chemical compound with the molecular formula C6H5F3N2O3 and a molecular weight of 210.11 g/mol. IUPAC name: 2-[5-oxo-3-(trifluoromethyl)-4H-pyrazol-1-yl]acetic acid. InChIKey: WNTKZYSMPROLOZ-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O3 |
|---|---|
| Molecular weight | 210.11 g/mol |
| IUPAC name | 2-[5-oxo-3-(trifluoromethyl)-4H-pyrazol-1-yl]acetic acid |
| InChIKey | WNTKZYSMPROLOZ-UHFFFAOYSA-N |
| SMILES | C1C(=NN(C1=O)CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)