CAS 944905-44-6 is the registry number for 5-(trifluoromethyl)pyrimidine-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-(trifluoromethyl)pyrimidine-2-carboxylic acid (CAS 944905-44-6) is a chemical compound with the molecular formula C6H3F3N2O2 and a molecular weight of 192.10 g/mol. IUPAC name: 5-(trifluoromethyl)pyrimidine-2-carboxylic acid. InChIKey: DMTVPKVFQQWGID-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N2O2 |
|---|---|
| Molecular weight | 192.10 g/mol |
| IUPAC name | 5-(trifluoromethyl)pyrimidine-2-carboxylic acid |
| InChIKey | DMTVPKVFQQWGID-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)