Products 944906-44-9
CAS 944906-44-9 is the registry number for 3-(4-Bromophenyl)-1,2,4-oxadiazole-5-carboxylic acid, 98%. Offered by: Chemat. Available pack sizes: 250mg.
3-(4-bromophenyl)-1,2,4-oxadiazole-5-carboxylic acid (CAS 944906-44-9) is a chemical compound with the molecular formula C9H5BrN2O3 and a molecular weight of 269.05 g/mol. IUPAC name: 3-(4-bromophenyl)-1,2,4-oxadiazole-5-carboxylic acid. InChIKey: COSBESOLWPQRSA-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O3 |
|---|---|
| Molecular weight | 269.05 g/mol |
| IUPAC name | 3-(4-bromophenyl)-1,2,4-oxadiazole-5-carboxylic acid |
| InChIKey | COSBESOLWPQRSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)C(=O)O)Br |
Computed by PubChem (NCBI)