CAS 945-81-3 is the registry number for N-Nitroso-N-ethyl-4-nitroaniline. Offered by: TRC. Available pack sizes: 100mg.
N-ethyl-N-(4-nitrophenyl)nitrous amide (CAS 945-81-3) is a chemical compound with the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. IUPAC name: N-ethyl-N-(4-nitrophenyl)nitrous amide. InChIKey: SBWNRAWQTOBKAD-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O3 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | N-ethyl-N-(4-nitrophenyl)nitrous amide |
| InChIKey | SBWNRAWQTOBKAD-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=C(C=C1)[N+](=O)[O-])N=O |
Computed by PubChem (NCBI)