Products 945550-23-2
CAS 945550-23-2 appears in our catalog under these names: 2,5-Dioxopyrrolidin-1-yl 2-(2-(2-azidoethoxy)ethoxy)acetate, 95%, Azido-PEG2-CH2CO2-NHS. Offered by: Ambeed, BLDpharm, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
(2,5-dioxopyrrolidin-1-yl) 2-[2-(2-azidoethoxy)ethoxy]acetate (CAS 945550-23-2) is a chemical compound with the molecular formula C10H14N4O6 and a molecular weight of 286.24 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-[2-(2-azidoethoxy)ethoxy]acetate. InChIKey: AKYVOJUTSASQJO-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O6 |
|---|---|
| Molecular weight | 286.24 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-[2-(2-azidoethoxy)ethoxy]acetate |
| InChIKey | AKYVOJUTSASQJO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)COCCOCCN=[N+]=[N-] |
Computed by PubChem (NCBI)