CAS 94574-45-5 is the registry number for 4-Phenyl-1-naphthoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
4-phenylnaphthalene-1-carboxylic acid (CAS 94574-45-5) is a chemical compound with the molecular formula C17H12O2 and a molecular weight of 248.27 g/mol. IUPAC name: 4-phenylnaphthalene-1-carboxylic acid. InChIKey: WQYUKAOSCJPKJB-UHFFFAOYSA-N.
| Molecular formula | C17H12O2 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 4-phenylnaphthalene-1-carboxylic acid |
| InChIKey | WQYUKAOSCJPKJB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)