Products 945892-88-6

CAS 945892-88-6 appears in our catalog under these names: 2,8-Diazaspiro(4.5)decan-3-one hydrochloride, 2,8-Diazaspiro[4.5]Decan-3-One Hydrochloride, 97%, 97%, 2,8-Diazaspiro[4.5]decan-3-one hydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2,8-diazaspiro[4.5]decan-3-one;hydrochloride (CAS 945892-88-6) is a chemical compound with the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. IUPAC name: 2,8-diazaspiro[4.5]decan-3-one;hydrochloride. InChIKey: AVGHORMRUXLILI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15ClN2O
Molecular weight190.67 g/mol
IUPAC name2,8-diazaspiro[4.5]decan-3-one;hydrochloride
InChIKeyAVGHORMRUXLILI-UHFFFAOYSA-N
SMILESC1CNCCC12CC(=O)NC2.Cl

Computed by PubChem (NCBI)