Products 945948-91-4

CAS 945948-91-4 is the registry number for Montelukast Impurity 36. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[1-(cyanomethyl)cyclopropyl]methyl carbamimidothioate (CAS 945948-91-4) is a chemical compound with the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. IUPAC name: [1-(cyanomethyl)cyclopropyl]methyl carbamimidothioate. InChIKey: ADMSNQMTFUQJGN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11N3S
Molecular weight169.25 g/mol
IUPAC name[1-(cyanomethyl)cyclopropyl]methyl carbamimidothioate
InChIKeyADMSNQMTFUQJGN-UHFFFAOYSA-N
SMILESC1CC1(CC#N)CSC(=N)N

Computed by PubChem (NCBI)