Products 946076-73-9
CAS 946076-73-9 is the registry number for 5-(4-Bromophenyl)-2-piperidone, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-(4-bromophenyl)piperidin-2-one (CAS 946076-73-9) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 5-(4-bromophenyl)piperidin-2-one. InChIKey: FDBGOSSOFAVGLI-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 5-(4-bromophenyl)piperidin-2-one |
| InChIKey | FDBGOSSOFAVGLI-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NCC1C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)