CAS 73387-60-7 is the registry number for (2E)-1-(4-Bromophenyl)-3-(dimethylamino)prop-2-en-1-one, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
(E)-1-(4-bromophenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 73387-60-7) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: (E)-1-(4-bromophenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: IGZLESKZUATMSD-BQYQJAHWSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | (E)-1-(4-bromophenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | IGZLESKZUATMSD-BQYQJAHWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)