Products 1803582-11-7
CAS 1803582-11-7 appears in our catalog under these names: 2,4-Dimethylquinolin-8-ol hydrobromide, 95%, 2,4-Dimethylquinolin-8-ol hydrobromide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 0,5g.
2,4-dimethylquinolin-8-ol;hydrobromide (CAS 1803582-11-7) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 2,4-dimethylquinolin-8-ol;hydrobromide. InChIKey: MEOJUYDEICAFAD-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 2,4-dimethylquinolin-8-ol;hydrobromide |
| InChIKey | MEOJUYDEICAFAD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=CC=C2O)C.Br |
Computed by PubChem (NCBI)