CAS 946125-65-1 appears in our catalog under these names: 1–(bromomethyl)–2–fluoro–3–nitrobenzene, 1-(bromomethyl)-2-fluoro-3-nitrobenzene 97%, 2-Fluoro-3-nitrobenzyl bromide, 2-FLUORO-3-NITROBENZYL BROMIDE, 97%. Offered by: GLPBio, Ambeed, Biosynth, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
1-(bromomethyl)-2-fluoro-3-nitrobenzene (CAS 946125-65-1) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 1-(bromomethyl)-2-fluoro-3-nitrobenzene. InChIKey: MIESICVJNXXYKC-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 1-(bromomethyl)-2-fluoro-3-nitrobenzene |
| InChIKey | MIESICVJNXXYKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])F)CBr |
Computed by PubChem (NCBI)