Products 946755-45-9
CAS 946755-45-9 is the registry number for 2-(Chloromethyl)-6-methyl-4(1h)-quinolinone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-(chloromethyl)-6-methyl-1H-quinolin-4-one (CAS 946755-45-9) is a chemical compound with the molecular formula C11H10ClNO and a molecular weight of 207.65 g/mol. IUPAC name: 2-(chloromethyl)-6-methyl-1H-quinolin-4-one. InChIKey: IEVBJWGWJUUPJE-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 2-(chloromethyl)-6-methyl-1H-quinolin-4-one |
| InChIKey | IEVBJWGWJUUPJE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=CC2=O)CCl |
Computed by PubChem (NCBI)