Products 947014-10-0

CAS 947014-10-0 is the registry number for ((1-Methyl-1H-benzimidazol-2-yl)methoxy)acetic acid. Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

2-[(1-methylbenzimidazol-2-yl)methoxy]acetic acid (CAS 947014-10-0) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 2-[(1-methylbenzimidazol-2-yl)methoxy]acetic acid. InChIKey: OTVNOCARSDKQRA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O3
Molecular weight220.22 g/mol
IUPAC name2-[(1-methylbenzimidazol-2-yl)methoxy]acetic acid
InChIKeyOTVNOCARSDKQRA-UHFFFAOYSA-N
SMILESCN1C2=CC=CC=C2N=C1COCC(=O)O

Computed by PubChem (NCBI)