CAS 948294-24-4 appears in our catalog under these names: 5-Chloro-8-methylquinoline-3-carboxylic acid, 95%, 5-Chloro-8-methylquinoline-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
5-chloro-8-methylquinoline-3-carboxylic acid (CAS 948294-24-4) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: 5-chloro-8-methylquinoline-3-carboxylic acid. InChIKey: CMJTVPDKPRZDHT-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 5-chloro-8-methylquinoline-3-carboxylic acid |
| InChIKey | CMJTVPDKPRZDHT-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Cl)C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)