CAS 949081-05-4 appears in our catalog under these names: 6–(4–Hydroxy–3–methylphenyl)–2–methylhept–2–en–4–one, 6-(4-Hydroxy-3-methylphenyl)-2-methylhept-2-en-4-one. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, Get quote.
(6S)-6-(4-hydroxy-3-methylphenyl)-2-methylhept-2-en-4-one (CAS 949081-05-4) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: (6S)-6-(4-hydroxy-3-methylphenyl)-2-methylhept-2-en-4-one. InChIKey: IBJADFSTHKILPU-NSHDSACASA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | (6S)-6-(4-hydroxy-3-methylphenyl)-2-methylhept-2-en-4-one |
| InChIKey | IBJADFSTHKILPU-NSHDSACASA-N |
| SMILES | CC1=C(C=CC(=C1)[C@@H](C)CC(=O)C=C(C)C)O |
Computed by PubChem (NCBI)